C63H51N4OPt-3 — CID 177105401
CID 177105401 (PubChem CID 177105401) has the molecular formula C63H51N4OPt-3 and a molecular weight of 1084.26 g/mol.
| Compound Name | CID 177105401 |
|---|---|
| PubChem CID | 177105401 |
| Molecular Formula | C63H51N4OPt-3 |
| Molecular Weight | 1084.26 g/mol |
| Exact Mass | 1083.43 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)c1ccc(Oc3[c-]c(N4[CH-]n5c6c(C)cccc6c6cc(C)ccc6c6ccccc6c6cccc4c65)ccc3C([2H])([2H])[2H])[c-]c1n2-c1cc(C([2H])([2H])[2H])c(-c2ccc(C(C)(C)C)cc2)cn1.[Pt] |
| InChI | InChI=1S/C63H51N4O.Pt/c1-38-19-28-49-47-14-9-10-15-48(47)51-17-12-18-57-62(51)66(61-41(4)13-11-16-52(61)53(49)31-38)37-65(57)45-26-21-40(3)59(34-45)68-46-27-29-50-54-32-39(2)20-30-56(54)67(58(50)35-46)60-33-42(5)55(36-64-60)43-22-24-44(25-23-43)63(6,7)8;/h9-33,36-37H,1-8H3;/q-3;/i2D3,3D3,5D3; |
| InChIKey | KGZMGOJAOMERSO-HEGRYCPTSA-N |
| XLogP | 16.73 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1084.26 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|