C33H36N4O6 — CID 164834025
tert-butyl 3-[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]-5-nitroindol-1-yl]propanoate (PubChem CID 164834025) has the molecular formula C33H36N4O6 and a molecular weight of 584.67 g/mol. Its IUPAC name is tert-butyl 3-[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]-5-nitroindol-1-yl]propanoate.
| Compound Name | tert-butyl 3-[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]-5-nitroindol-1-yl]propanoate |
|---|---|
| PubChem CID | 164834025 |
| Molecular Formula | C33H36N4O6 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | tert-butyl 3-[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]-5-nitroindol-1-yl]propanoate |
| SMILES | CN(Cc1cc2cc([N+](=O)[O-])ccc2n1CCC(=O)OC(C)(C)C)N(C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H36N4O6/c1-33(2,3)43-31(38)16-17-36-24(19-22-18-23(37(40)41)14-15-30(22)36)20-34(4)35(5)32(39)42-21-29-27-12-8-6-10-25(27)26-11-7-9-13-28(26)29/h6-15,18-19,29H,16-17,20-21H2,1-5H3 |
| InChIKey | WFGVOENSCHONIX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 107.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|