C46H58N4O10 — CID 161065257
tert-butyl (4R)-4-[2-(2-ethoxyethoxy)ethylcarbamoyl]-8-[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]indol-1-yl]-6-oxooctanoate;carbon dioxide (PubChem CID 161065257) has the molecular formula C46H58N4O10 and a molecular weight of 826.99 g/mol. Its IUPAC name is tert-butyl (4R)-4-[2-(2-ethoxyethoxy)ethylcarbamoyl]-8-[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]indol-1-yl]-6-oxooctanoate;carbon dioxide.
| Compound Name | tert-butyl (4R)-4-[2-(2-ethoxyethoxy)ethylcarbamoyl]-8-[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]indol-1-yl]-6-oxooctanoate;carbon dioxide |
|---|---|
| PubChem CID | 161065257 |
| Molecular Formula | C46H58N4O10 |
| Molecular Weight | 826.99 g/mol |
| Exact Mass | 826.42 |
| IUPAC Name | tert-butyl (4R)-4-[2-(2-ethoxyethoxy)ethylcarbamoyl]-8-[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]indol-1-yl]-6-oxooctanoate;carbon dioxide |
| SMILES | CCOCCOCCNC(=O)[C@H](CCC(=O)OC(C)(C)C)CC(=O)CCn1c(CN(C)N(C)C(=O)OCC2c3ccccc3-c3ccccc32)cc2ccccc21.O=C=O |
| InChI | InChI=1S/C45H58N4O8.CO2/c1-7-54-26-27-55-25-23-46-43(52)33(20-21-42(51)57-45(2,3)4)29-35(50)22-24-49-34(28-32-14-8-13-19-41(32)49)30-47(5)48(6)44(53)56-31-40-38-17-11-9-15-36(38)37-16-10-12-18-39(37)40;2-1-3/h8-19,28,33,40H,7,20-27,29-31H2,1-6H3,(H,46,52);/t33-;/m1./s1 |
| InChIKey | UDYAVUFNTSIJLJ-MGDILKBHSA-N |
| XLogP | 6.54 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.99 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|