C23H25F3N8OS — CID 164834506
2,5-dimethyl-13-[4-(4-methylpiperazin-1-yl)anilino]-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 164834506) has the molecular formula C23H25F3N8OS and a molecular weight of 518.57 g/mol. Its IUPAC name is 2,5-dimethyl-13-[4-(4-methylpiperazin-1-yl)anilino]-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 2,5-dimethyl-13-[4-(4-methylpiperazin-1-yl)anilino]-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 164834506 |
| Molecular Formula | C23H25F3N8OS |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2,5-dimethyl-13-[4-(4-methylpiperazin-1-yl)anilino]-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | Cc1nc2c(s1)N(C)c1nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc1N(CC(F)(F)F)C2=O |
| InChI | InChI=1S/C23H25F3N8OS/c1-14-28-18-20(35)34(13-23(24,25)26)17-12-27-22(30-19(17)32(3)21(18)36-14)29-15-4-6-16(7-5-15)33-10-8-31(2)9-11-33/h4-7,12H,8-11,13H2,1-3H3,(H,27,29,30) |
| InChIKey | MBKHZTSZCCLRSH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|