C27H27N5O3 — CID 164836582
3-[6-[[1-[(7S)-4-azaspiro[2.5]octan-7-yl]pyrazol-4-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione (PubChem CID 164836582) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 3-[6-[[1-[(7S)-4-azaspiro[2.5]octan-7-yl]pyrazol-4-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[1-[(7S)-4-azaspiro[2.5]octan-7-yl]pyrazol-4-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164836582 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-[6-[[1-[(7S)-4-azaspiro[2.5]octan-7-yl]pyrazol-4-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(Cc5cnn([C@H]6CCNC7(CC7)C6)c5)ccc2c34)C(=O)N1 |
| InChI | InChI=1S/C27H27N5O3/c33-23-7-6-22(25(34)30-23)32-21-5-4-17(19-2-1-3-20(24(19)21)26(32)35)12-16-14-29-31(15-16)18-8-11-28-27(13-18)9-10-27/h1-5,14-15,18,22,28H,6-13H2,(H,30,33,34)/t18-,22?/m0/s1 |
| InChIKey | KKILUABQWQAFBV-HXBUSHRASA-N |
| XLogP | 2.85 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|