C54H33N5 — CID 164839319
3-(4,6-diphenyl-2-pyridinyl)-11-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene (PubChem CID 164839319) has the molecular formula C54H33N5 and a molecular weight of 751.89 g/mol. Its IUPAC name is 3-(4,6-diphenyl-2-pyridinyl)-11-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene.
| Compound Name | 3-(4,6-diphenyl-2-pyridinyl)-11-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene |
|---|---|
| PubChem CID | 164839319 |
| Molecular Formula | C54H33N5 |
| Molecular Weight | 751.89 g/mol |
| Exact Mass | 751.27 |
| IUPAC Name | 3-(4,6-diphenyl-2-pyridinyl)-11-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cccc4c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c6c7cccc8cccc(c87)n(c34)c56)c2)cc1 |
| InChI | InChI=1S/C54H33N5/c1-5-16-34(17-6-1)39-32-45(35-18-7-2-8-19-35)55-46(33-39)42-27-15-26-40-41-30-31-44(49-43-28-13-24-36-25-14-29-47(48(36)43)59(50(40)42)51(41)49)54-57-52(37-20-9-3-10-21-37)56-53(58-54)38-22-11-4-12-23-38/h1-33H |
| InChIKey | RXVFFBQRTJYQNC-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.89 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|