C41H24N6 — CID 164839395
10-[4-(5-phenylpyrimidin-2-yl)-6-pyridin-4-ylpyrimidin-2-yl]-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene (PubChem CID 164839395) has the molecular formula C41H24N6 and a molecular weight of 600.69 g/mol. Its IUPAC name is 10-[4-(5-phenylpyrimidin-2-yl)-6-pyridin-4-ylpyrimidin-2-yl]-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene.
| Compound Name | 10-[4-(5-phenylpyrimidin-2-yl)-6-pyridin-4-ylpyrimidin-2-yl]-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene |
|---|---|
| PubChem CID | 164839395 |
| Molecular Formula | C41H24N6 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 10-[4-(5-phenylpyrimidin-2-yl)-6-pyridin-4-ylpyrimidin-2-yl]-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17(23),18,20-undecaene |
| SMILES | c1ccc(-c2cnc(-c3cc(-c4ccncc4)nc(-c4cc5c6cccc7cccc(c76)n6c7ccccc7c(c4)c56)n3)nc2)cc1 |
| InChI | InChI=1S/C41H24N6/c1-2-8-25(9-3-1)29-23-43-41(44-24-29)35-22-34(26-16-18-42-19-17-26)45-40(46-35)28-20-32-30-12-4-5-14-36(30)47-37-15-7-11-27-10-6-13-31(38(27)37)33(21-28)39(32)47/h1-24H |
| InChIKey | USILCZRIGSGENC-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|