C52H31N7 — CID 164839242
5,10-bis(4,6-dipyridin-2-yl-2-pyridinyl)-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8,10,12(22),13,15,17(23),18,20-undecaene (PubChem CID 164839242) has the molecular formula C52H31N7 and a molecular weight of 753.87 g/mol. Its IUPAC name is 5,10-bis(4,6-dipyridin-2-yl-2-pyridinyl)-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8,10,12(22),13,15,17(23),18,20-undecaene.
| Compound Name | 5,10-bis(4,6-dipyridin-2-yl-2-pyridinyl)-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8,10,12(22),13,15,17(23),18,20-undecaene |
|---|---|
| PubChem CID | 164839242 |
| Molecular Formula | C52H31N7 |
| Molecular Weight | 753.87 g/mol |
| Exact Mass | 753.26 |
| IUPAC Name | 5,10-bis(4,6-dipyridin-2-yl-2-pyridinyl)-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8,10,12(22),13,15,17(23),18,20-undecaene |
| SMILES | c1ccc(-c2cc(-c3ccc4c(c3)c3cc(-c5cc(-c6ccccn6)cc(-c6ccccn6)n5)cc5c6cccc7cccc(c76)n4c53)nc(-c3ccccn3)c2)nc1 |
| InChI | InChI=1S/C52H31N7/c1-5-21-53-41(14-1)35-28-45(57-47(30-35)43-16-3-7-23-55-43)33-19-20-49-38(25-33)40-27-34(26-39-37-13-9-11-32-12-10-18-50(51(32)37)59(49)52(39)40)46-29-36(42-15-2-6-22-54-42)31-48(58-46)44-17-4-8-24-56-44/h1-31H |
| InChIKey | XJGJHOYCHUKDMY-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.87 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|