C25H28Cl2N8O4 — CID 164839663
tert-butyl (7R)-15-(1-tert-butyl-4-isocyanopyrazol-5-yl)-11,12-dichloro-16-oxo-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-5-carboxylate (PubChem CID 164839663) has the molecular formula C25H28Cl2N8O4 and a molecular weight of 575.46 g/mol. Its IUPAC name is tert-butyl (7R)-15-(1-tert-butyl-4-isocyanopyrazol-5-yl)-11,12-dichloro-16-oxo-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-5-carboxylate.
| Compound Name | tert-butyl (7R)-15-(1-tert-butyl-4-isocyanopyrazol-5-yl)-11,12-dichloro-16-oxo-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 164839663 |
| Molecular Formula | C25H28Cl2N8O4 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | tert-butyl (7R)-15-(1-tert-butyl-4-isocyanopyrazol-5-yl)-11,12-dichloro-16-oxo-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-5-carboxylate |
| SMILES | [C-]#[N+]c1cnn(C(C)(C)C)c1-n1c(=O)nc2c3c(c(Cl)c(Cl)nc31)OC[C@H]1CN(C(=O)OC(C)(C)C)CCN21 |
| InChI | InChI=1S/C25H28Cl2N8O4/c1-24(2,3)35-21(14(28-7)10-29-35)34-20-15-17(16(26)18(27)30-20)38-12-13-11-32(23(37)39-25(4,5)6)8-9-33(13)19(15)31-22(34)36/h10,13H,8-9,11-12H2,1-6H3/t13-/m1/s1 |
| InChIKey | NPTROVYGIBILPK-CYBMUJFWSA-N |
| XLogP | 4.41 |
| TPSA | 111.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|