C26H30ClFN6O4 — CID 164840017
tert-butyl (7R)-12-chloro-11-fluoro-15-(2-methyl-4-propan-2-yl-3-pyridinyl)-16-oxo-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-5-carboxylate (PubChem CID 164840017) has the molecular formula C26H30ClFN6O4 and a molecular weight of 545.02 g/mol. Its IUPAC name is tert-butyl (7R)-12-chloro-11-fluoro-15-(2-methyl-4-propan-2-yl-3-pyridinyl)-16-oxo-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-5-carboxylate.
| Compound Name | tert-butyl (7R)-12-chloro-11-fluoro-15-(2-methyl-4-propan-2-yl-3-pyridinyl)-16-oxo-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 164840017 |
| Molecular Formula | C26H30ClFN6O4 |
| Molecular Weight | 545.02 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | tert-butyl (7R)-12-chloro-11-fluoro-15-(2-methyl-4-propan-2-yl-3-pyridinyl)-16-oxo-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-5-carboxylate |
| SMILES | Cc1nccc(C(C)C)c1-n1c(=O)nc2c3c(c(F)c(Cl)nc31)OC[C@H]1CN(C(=O)OC(C)(C)C)CCN21 |
| InChI | InChI=1S/C26H30ClFN6O4/c1-13(2)16-7-8-29-14(3)19(16)34-23-17-20(18(28)21(27)30-23)37-12-15-11-32(25(36)38-26(4,5)6)9-10-33(15)22(17)31-24(34)35/h7-8,13,15H,9-12H2,1-6H3/t15-/m1/s1 |
| InChIKey | FIVMAGOXFKEWMK-OAHLLOKOSA-N |
| XLogP | 4.22 |
| TPSA | 102.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.02 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|