C27H30O — CID 164845409
3-(3,5-ditert-butylphenyl)-4-methyldibenzofuran (PubChem CID 164845409) has the molecular formula C27H30O and a molecular weight of 370.54 g/mol. Its IUPAC name is 3-(3,5-ditert-butylphenyl)-4-methyldibenzofuran.
| Compound Name | 3-(3,5-ditert-butylphenyl)-4-methyldibenzofuran |
|---|---|
| PubChem CID | 164845409 |
| Molecular Formula | C27H30O |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 3-(3,5-ditert-butylphenyl)-4-methyldibenzofuran |
| SMILES | Cc1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)ccc2c1oc1ccccc12 |
| InChI | InChI=1S/C27H30O/c1-17-21(12-13-23-22-10-8-9-11-24(22)28-25(17)23)18-14-19(26(2,3)4)16-20(15-18)27(5,6)7/h8-16H,1-7H3 |
| InChIKey | BGSSMEPZSQRHJY-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |