C41H40N6O6 — CID 164846391
5-[3-[2-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-(1-isocyanocyclopropyl)anilino]ethoxy]pyrrolidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 164846391) has the molecular formula C41H40N6O6 and a molecular weight of 712.81 g/mol. Its IUPAC name is 5-[3-[2-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-(1-isocyanocyclopropyl)anilino]ethoxy]pyrrolidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[2-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-(1-isocyanocyclopropyl)anilino]ethoxy]pyrrolidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 164846391 |
| Molecular Formula | C41H40N6O6 |
| Molecular Weight | 712.81 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | 5-[3-[2-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-4-(1-isocyanocyclopropyl)anilino]ethoxy]pyrrolidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | [C-]#[N+]C1(c2ccc(N(CCOC3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)C3)c3cc(-c4c(C)noc4C)ccc3C)cc2)CC1 |
| InChI | InChI=1S/C41H40N6O6/c1-24-5-6-27(37-25(2)44-53-26(37)3)21-35(24)46(29-9-7-28(8-10-29)41(42-4)16-17-41)19-20-52-31-15-18-45(23-31)30-11-12-32-33(22-30)40(51)47(39(32)50)34-13-14-36(48)43-38(34)49/h5-12,21-22,31,34H,13-20,23H2,1-3H3,(H,43,48,49) |
| InChIKey | ZHYVMEQXIBYKPM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.81 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|