C33H23FNOS+ — CID 164849391
2-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 164849391) has the molecular formula C33H23FNOS+ and a molecular weight of 500.62 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 164849391 |
| Molecular Formula | C33H23FNOS+ |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(-c5ccccc5)cc4)c(F)ccc32)c1-c1sc2ccccc2[n+]1C |
| InChI | InChI=1S/C33H23FNOS/c1-20-12-17-24-25-18-19-26(34)30(23-15-13-22(14-16-23)21-8-4-3-5-9-21)32(25)36-31(24)29(20)33-35(2)27-10-6-7-11-28(27)37-33/h3-19H,1-2H3/q+1 |
| InChIKey | BYOYKEGHGUJUPX-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|