C30H20FN2OS+ — CID 164849393
6-(6-dibenzothiophen-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-1-methylpyrimidin-1-ium (PubChem CID 164849393) has the molecular formula C30H20FN2OS+ and a molecular weight of 475.57 g/mol. Its IUPAC name is 6-(6-dibenzothiophen-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-1-methylpyrimidin-1-ium.
| Compound Name | 6-(6-dibenzothiophen-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-1-methylpyrimidin-1-ium |
|---|---|
| PubChem CID | 164849393 |
| Molecular Formula | C30H20FN2OS+ |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 6-(6-dibenzothiophen-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-1-methylpyrimidin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)sc4ccccc45)c(F)ccc32)c1-c1ccnc[n+]1C |
| InChI | InChI=1S/C30H20FN2OS/c1-17-7-9-21-22-11-12-23(31)28(30(22)34-29(21)27(17)24-13-14-32-16-33(24)2)18-8-10-20-19-5-3-4-6-25(19)35-26(20)15-18/h3-16H,1-2H3/q+1 |
| InChIKey | FEHDXDCAGUUNIC-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|