C36H31N2O+ — CID 164849922
4-[4-(3-tert-butylphenyl)phenyl]-6-(6-deuterio-1-methylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile (PubChem CID 164849922) has the molecular formula C36H31N2O+ and a molecular weight of 508.66 g/mol. Its IUPAC name is 4-[4-(3-tert-butylphenyl)phenyl]-6-(6-deuterio-1-methylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile.
| Compound Name | 4-[4-(3-tert-butylphenyl)phenyl]-6-(6-deuterio-1-methylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 164849922 |
| Molecular Formula | C36H31N2O+ |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 4-[4-(3-tert-butylphenyl)phenyl]-6-(6-deuterio-1-methylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile |
| SMILES | [2H]c1cccc(-c2c(C)ccc3c2oc2c(-c4ccc(-c5cccc(C(C)(C)C)c5)cc4)c(C#N)ccc23)[n+]1C |
| InChI | InChI=1S/C36H31N2O/c1-23-12-18-29-30-19-17-27(22-37)33(35(30)39-34(29)32(23)31-11-6-7-20-38(31)5)25-15-13-24(14-16-25)26-9-8-10-28(21-26)36(2,3)4/h6-21H,1-5H3/q+1/i20D |
| InChIKey | AWGCBXXNAMXKEO-YVHRXSIGSA-N |
| XLogP | 8.89 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|