C28H24ClF3N8 — CID 164850542
9-[[5-[(3R)-3-amino-3-(6-chloro-3-fluoro-2-pyridinyl)cyclohexyl]-2-(3,4-difluorophenyl)-4-pyridinyl]methyl]purin-6-amine (PubChem CID 164850542) has the molecular formula C28H24ClF3N8 and a molecular weight of 565.00 g/mol. Its IUPAC name is 9-[[5-[(3R)-3-amino-3-(6-chloro-3-fluoro-2-pyridinyl)cyclohexyl]-2-(3,4-difluorophenyl)-4-pyridinyl]methyl]purin-6-amine.
| Compound Name | 9-[[5-[(3R)-3-amino-3-(6-chloro-3-fluoro-2-pyridinyl)cyclohexyl]-2-(3,4-difluorophenyl)-4-pyridinyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 164850542 |
| Molecular Formula | C28H24ClF3N8 |
| Molecular Weight | 565.00 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 9-[[5-[(3R)-3-amino-3-(6-chloro-3-fluoro-2-pyridinyl)cyclohexyl]-2-(3,4-difluorophenyl)-4-pyridinyl]methyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2Cc1cc(-c2ccc(F)c(F)c2)ncc1C1CCC[C@](N)(c2nc(Cl)ccc2F)C1 |
| InChI | InChI=1S/C28H24ClF3N8/c29-23-6-5-20(31)25(39-23)28(34)7-1-2-16(10-28)18-11-35-22(15-3-4-19(30)21(32)8-15)9-17(18)12-40-14-38-24-26(33)36-13-37-27(24)40/h3-6,8-9,11,13-14,16H,1-2,7,10,12,34H2,(H2,33,36,37)/t16?,28-/m1/s1 |
| InChIKey | USILTGLPCKMFRE-GMTYSHBUSA-N |
| XLogP | 5.50 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.00 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|