C24H23Cl2N9S — CID 164850801
[(1S,6R,7S)-3-[3-(3,4-dichloro-2-methylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine (PubChem CID 164850801) has the molecular formula C24H23Cl2N9S and a molecular weight of 540.48 g/mol. Its IUPAC name is [(1S,6R,7S)-3-[3-(3,4-dichloro-2-methylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine.
| Compound Name | [(1S,6R,7S)-3-[3-(3,4-dichloro-2-methylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
|---|---|
| PubChem CID | 164850801 |
| Molecular Formula | C24H23Cl2N9S |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | [(1S,6R,7S)-3-[3-(3,4-dichloro-2-methylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
| SMILES | Cc1csc([C@@]2(CN)[C@@H]3CCN(c4cnc5c(-c6ccc7nn(C)c(Cl)c7c6Cl)[nH]nc5n4)C[C@@H]32)n1 |
| InChI | InChI=1S/C24H23Cl2N9S/c1-11-9-36-23(29-11)24(10-27)13-5-6-35(8-14(13)24)16-7-28-20-19(31-32-22(20)30-16)12-3-4-15-17(18(12)25)21(26)34(2)33-15/h3-4,7,9,13-14H,5-6,8,10,27H2,1-2H3,(H,30,31,32)/t13-,14+,24+/m1/s1 |
| InChIKey | WFLJLDJJKHEAAD-CDEUHXGRSA-N |
| XLogP | 4.33 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |