C25H26ClN9O — CID 164851067
[(1S,6R,7S)-3-[3-(4-chloro-2,3-dimethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine (PubChem CID 164851067) has the molecular formula C25H26ClN9O and a molecular weight of 504.00 g/mol. Its IUPAC name is [(1S,6R,7S)-3-[3-(4-chloro-2,3-dimethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine.
| Compound Name | [(1S,6R,7S)-3-[3-(4-chloro-2,3-dimethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
|---|---|
| PubChem CID | 164851067 |
| Molecular Formula | C25H26ClN9O |
| Molecular Weight | 504.00 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | [(1S,6R,7S)-3-[3-(4-chloro-2,3-dimethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]-7-(5-methyl-1,2-oxazol-3-yl)-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
| SMILES | Cc1cc([C@@]2(CN)[C@@H]3CCN(c4cnc5c(-c6ccc7nn(C)c(C)c7c6Cl)[nH]nc5n4)C[C@@H]32)no1 |
| InChI | InChI=1S/C25H26ClN9O/c1-12-8-18(33-36-12)25(11-27)15-6-7-35(10-16(15)25)19-9-28-23-22(30-31-24(23)29-19)14-4-5-17-20(21(14)26)13(2)34(3)32-17/h4-5,8-9,15-16H,6-7,10-11,27H2,1-3H3,(H,29,30,31)/t15-,16+,25+/m1/s1 |
| InChIKey | FSVRQAPFDUETIJ-TWKFVSLJSA-N |
| XLogP | 3.52 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.00 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |