About US20240109900, Example 144
US20240109900, Example 144 (PubChem CID 164850822) has the molecular formula C27H22F4N8O
and a molecular weight of 550.50 g/mol. Its IUPAC name is [(1S,6R,7S)-7-(3-fluoro-2-pyridinyl)-3-[3-[8-(trifluoromethoxy)quinolin-5-yl]-2H-pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methanamine.
Molecular Properties
| Compound Name | US20240109900, Example 144 |
| PubChem CID | 164850822 |
| Molecular Formula | C27H22F4N8O |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | [(1S,6R,7S)-7-(3-fluoro-2-pyridinyl)-3-[3-[8-(trifluoromethoxy)quinolin-5-yl]-2H-pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methanamine |
| SMILES | C1CN(C[C@H]2[C@@H]1[C@]2(CN)C3=C(C=CC=N3)F)C4=NC5=NNC(=C5N=C4)C6=C7C=CC=NC7=C(C=C6)OC(F)(F)F |
| InChI | InChI=1S/C27H22F4N8O/c28-18-4-2-9-34-24(18)26(13-32)16-7-10-39(12-17(16)26)20-11-35-23-22(37-38-25(23)36-20)15-5-6-19(40-27(29,30)31)21-14(15)3-1-8-33-21/h1-6,8-9,11,16-17H,7,10,12-13,32H2,(H,36,37,38)/t16-,17+,26+/m1/s1 |
| InChIKey | FTWOTDOIXIDILY-XJCBTKLQSA-N |
| XLogP | 3.70 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | 916 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze US20240109900, Example 144 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US20240109900, Example 144?
The IUPAC name of US20240109900, Example 144 (CID 164850822) is [(1S,6R,7S)-7-(3-fluoro-2-pyridinyl)-3-[3-[8-(trifluoromethoxy)quinolin-5-yl]-2H-pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methanamine.
What is the SMILES notation for US20240109900, Example 144?
The canonical SMILES for US20240109900, Example 144 is C1CN(C[C@H]2[C@@H]1[C@]2(CN)C3=C(C=CC=N3)F)C4=NC5=NNC(=C5N=C4)C6=C7C=CC=NC7=C(C=C6)OC(F)(F)F.
What is the InChIKey of US20240109900, Example 144?
The InChIKey is FTWOTDOIXIDILY-XJCBTKLQSA-N. The full InChI is InChI=1S/C27H22F4N8O/c28-18-4-2-9-34-24(18)26(13-32)16-7-10-39(12-17(16)26)20-11-35-23-22(37-38-25(23)36-20)15-5-6-19(40-27(29,30)31)21-14(15)3-1-8-33-21/h1-6,8-9,11,16-17H,7,10,12-13,32H2,(H,36,37,38)/t16-,17+,26+/m1/s1.
What are the key properties of US20240109900, Example 144?
US20240109900, Example 144 has a molecular weight of 550.50 g/mol, XLogP of 3.70, 5 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for US20240109900, Example 144 is sourced from PubChem (CID 164850822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).