C16H14F3N3 — CID 164852052
5-[3-(trifluoromethyl)piperidin-1-yl]quinoline-8-carbonitrile (PubChem CID 164852052) has the molecular formula C16H14F3N3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)piperidin-1-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[3-(trifluoromethyl)piperidin-1-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 164852052 |
| Molecular Formula | C16H14F3N3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 5-[3-(trifluoromethyl)piperidin-1-yl]quinoline-8-carbonitrile |
| SMILES | N#Cc1ccc(N2CCCC(C(F)(F)F)C2)c2cccnc12 |
| InChI | InChI=1S/C16H14F3N3/c17-16(18,19)12-3-2-8-22(10-12)14-6-5-11(9-20)15-13(14)4-1-7-21-15/h1,4-7,12H,2-3,8,10H2 |
| InChIKey | BDHVZYKGLSOEFJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |