C28H25F3N4O — CID 164852755
3-[4-(3-methylphenyl)piperazin-1-yl]-N-[7-(trifluoromethyl)quinolin-4-yl]benzamide (PubChem CID 164852755) has the molecular formula C28H25F3N4O and a molecular weight of 490.53 g/mol. Its IUPAC name is 3-[4-(3-methylphenyl)piperazin-1-yl]-N-[7-(trifluoromethyl)quinolin-4-yl]benzamide.
| Compound Name | 3-[4-(3-methylphenyl)piperazin-1-yl]-N-[7-(trifluoromethyl)quinolin-4-yl]benzamide |
|---|---|
| PubChem CID | 164852755 |
| Molecular Formula | C28H25F3N4O |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 3-[4-(3-methylphenyl)piperazin-1-yl]-N-[7-(trifluoromethyl)quinolin-4-yl]benzamide |
| SMILES | Cc1cccc(N2CCN(c3cccc(C(=O)Nc4ccnc5cc(C(F)(F)F)ccc45)c3)CC2)c1 |
| InChI | InChI=1S/C28H25F3N4O/c1-19-4-2-6-22(16-19)34-12-14-35(15-13-34)23-7-3-5-20(17-23)27(36)33-25-10-11-32-26-18-21(28(29,30)31)8-9-24(25)26/h2-11,16-18H,12-15H2,1H3,(H,32,33,36) |
| InChIKey | BLFUZEPXDDMQDH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |