C28H26N4O — CID 164853233
4-[3-[(3S)-3-aminopiperidine-1-carbonyl]-6-(4-methylphenyl)-1H-indol-5-yl]benzonitrile (PubChem CID 164853233) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-[3-[(3S)-3-aminopiperidine-1-carbonyl]-6-(4-methylphenyl)-1H-indol-5-yl]benzonitrile.
| Compound Name | 4-[3-[(3S)-3-aminopiperidine-1-carbonyl]-6-(4-methylphenyl)-1H-indol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 164853233 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-[3-[(3S)-3-aminopiperidine-1-carbonyl]-6-(4-methylphenyl)-1H-indol-5-yl]benzonitrile |
| SMILES | Cc1ccc(-c2cc3[nH]cc(C(=O)N4CCC[C@H](N)C4)c3cc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C28H26N4O/c1-18-4-8-20(9-5-18)24-14-27-25(13-23(24)21-10-6-19(15-29)7-11-21)26(16-31-27)28(33)32-12-2-3-22(30)17-32/h4-11,13-14,16,22,31H,2-3,12,17,30H2,1H3/t22-/m0/s1 |
| InChIKey | SNAXHHZZWGGTDG-QFIPXVFZSA-N |
| XLogP | 5.25 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |