C27H54ClNO3 — CID 164853913
didecyl-[2-(2-prop-2-enoyloxyethoxy)ethyl]azanium chloride (PubChem CID 164853913) has the molecular formula C27H54ClNO3 and a molecular weight of 476.19 g/mol. Its IUPAC name is didecyl-[2-(2-prop-2-enoyloxyethoxy)ethyl]azanium chloride.
| Compound Name | didecyl-[2-(2-prop-2-enoyloxyethoxy)ethyl]azanium chloride |
|---|---|
| PubChem CID | 164853913 |
| Molecular Formula | C27H54ClNO3 |
| Molecular Weight | 476.19 g/mol |
| Exact Mass | 475.38 |
| IUPAC Name | didecyl-[2-(2-prop-2-enoyloxyethoxy)ethyl]azanium chloride |
| SMILES | C=CC(=O)OCCOCC[NH+](CCCCCCCCCC)CCCCCCCCCC.[Cl-] |
| InChI | InChI=1S/C27H53NO3.ClH/c1-4-7-9-11-13-15-17-19-21-28(22-20-18-16-14-12-10-8-5-2)23-24-30-25-26-31-27(29)6-3;/h6H,3-5,7-26H2,1-2H3;1H |
| InChIKey | OKGVSAHFNBTVKS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|