C18H31N3O — CID 164857013
ethane;1-(4-methylphenyl)propane-1,2-diimine;oxan-2-ylmethanamine (PubChem CID 164857013) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is ethane;1-(4-methylphenyl)propane-1,2-diimine;oxan-2-ylmethanamine.
| Compound Name | ethane;1-(4-methylphenyl)propane-1,2-diimine;oxan-2-ylmethanamine |
|---|---|
| PubChem CID | 164857013 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | ethane;1-(4-methylphenyl)propane-1,2-diimine;oxan-2-ylmethanamine |
| SMILES | CC.NCC1CCCCO1.[H]/N=C(C(\C)=N\[H])/c1ccc(C)cc1 |
| InChI | InChI=1S/C10H12N2.C6H13NO.C2H6/c1-7-3-5-9(6-4-7)10(12)8(2)11;7-5-6-3-1-2-4-8-6;1-2/h3-6,11-12H,1-2H3;6H,1-5,7H2;1-2H3/b11-8+,12-10+;; |
| InChIKey | PSGFGRCVKMYMBN-PNWGBGJUSA-N |
| XLogP | 3.94 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|