About ethane;nitrobenzene;oxan-2-ylmethanamine
ethane;nitrobenzene;oxan-2-ylmethanamine (PubChem CID 164858144) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is ethane;nitrobenzene;oxan-2-ylmethanamine.
Molecular Properties
| Compound Name | ethane;nitrobenzene;oxan-2-ylmethanamine |
| PubChem CID | 164858144 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | ethane;nitrobenzene;oxan-2-ylmethanamine |
| SMILES | CC.NCC1CCCCO1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C6H13NO.C2H6/c8-7(9)6-4-2-1-3-5-6;7-5-6-3-1-2-4-8-6;1-2/h1-5H;6H,1-5,7H2;1-2H3 |
| InChIKey | ATCUWAOFVLNKLW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;nitrobenzene;oxan-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;nitrobenzene;oxan-2-ylmethanamine?
The IUPAC name of ethane;nitrobenzene;oxan-2-ylmethanamine (CID 164858144) is ethane;nitrobenzene;oxan-2-ylmethanamine.
What is the SMILES notation for ethane;nitrobenzene;oxan-2-ylmethanamine?
The canonical SMILES for ethane;nitrobenzene;oxan-2-ylmethanamine is CC.NCC1CCCCO1.O=[N+]([O-])c1ccccc1.
What is the InChIKey of ethane;nitrobenzene;oxan-2-ylmethanamine?
The InChIKey is ATCUWAOFVLNKLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C6H13NO.C2H6/c8-7(9)6-4-2-1-3-5-6;7-5-6-3-1-2-4-8-6;1-2/h1-5H;6H,1-5,7H2;1-2H3.
What are the key properties of ethane;nitrobenzene;oxan-2-ylmethanamine?
ethane;nitrobenzene;oxan-2-ylmethanamine has a molecular weight of 268.36 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;nitrobenzene;oxan-2-ylmethanamine is sourced from PubChem (CID 164858144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).