C15H19BrN2O3 — CID 164857060
2-[2-bromo-2-(oxan-2-yl)propanoyl]benzohydrazide (PubChem CID 164857060) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is 2-[2-bromo-2-(oxan-2-yl)propanoyl]benzohydrazide.
| Compound Name | 2-[2-bromo-2-(oxan-2-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 164857060 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-[2-bromo-2-(oxan-2-yl)propanoyl]benzohydrazide |
| SMILES | CC(Br)(C(=O)c1ccccc1C(=O)NN)C1CCCCO1 |
| InChI | InChI=1S/C15H19BrN2O3/c1-15(16,12-8-4-5-9-21-12)13(19)10-6-2-3-7-11(10)14(20)18-17/h2-3,6-7,12H,4-5,8-9,17H2,1H3,(H,18,20) |
| InChIKey | OZICHQNFCBPHAN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|