C21H26N4O2 — CID 164858572
(1Z)-1-hydrazinylidene-N-(oxan-2-ylmethyl)-1-[4-(pyridin-2-ylmethoxy)phenyl]propan-2-imine (PubChem CID 164858572) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (1Z)-1-hydrazinylidene-N-(oxan-2-ylmethyl)-1-[4-(pyridin-2-ylmethoxy)phenyl]propan-2-imine.
| Compound Name | (1Z)-1-hydrazinylidene-N-(oxan-2-ylmethyl)-1-[4-(pyridin-2-ylmethoxy)phenyl]propan-2-imine |
|---|---|
| PubChem CID | 164858572 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (1Z)-1-hydrazinylidene-N-(oxan-2-ylmethyl)-1-[4-(pyridin-2-ylmethoxy)phenyl]propan-2-imine |
| SMILES | CC(=N\CC1CCCCO1)/C(=N\N)c1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C21H26N4O2/c1-16(24-14-20-7-3-5-13-26-20)21(25-22)17-8-10-19(11-9-17)27-15-18-6-2-4-12-23-18/h2,4,6,8-12,20H,3,5,7,13-15,22H2,1H3/b24-16+,25-21+ |
| InChIKey | OELNOPWTJILYNI-ADGWQJBRSA-N |
| XLogP | 3.35 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|