C31H28FIN6O3 — CID 164860260
2-[[(1S,6R,7R)-7-(2-fluorophenyl)-3-[3-iodo-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methyl]isoindole-1,3-dione (PubChem CID 164860260) has the molecular formula C31H28FIN6O3 and a molecular weight of 678.51 g/mol. Its IUPAC name is 2-[[(1S,6R,7R)-7-(2-fluorophenyl)-3-[3-iodo-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(1S,6R,7R)-7-(2-fluorophenyl)-3-[3-iodo-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164860260 |
| Molecular Formula | C31H28FIN6O3 |
| Molecular Weight | 678.51 g/mol |
| Exact Mass | 678.13 |
| IUPAC Name | 2-[[(1S,6R,7R)-7-(2-fluorophenyl)-3-[3-iodo-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]-3-azabicyclo[4.1.0]heptan-7-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@]1(c2ccccc2F)[C@@H]2CCN(c3cnc4c(I)nn(C5CCCCO5)c4n3)C[C@@H]21 |
| InChI | InChI=1S/C31H28FIN6O3/c32-23-10-4-3-9-21(23)31(17-38-29(40)18-7-1-2-8-19(18)30(38)41)20-12-13-37(16-22(20)31)24-15-34-26-27(33)36-39(28(26)35-24)25-11-5-6-14-42-25/h1-4,7-10,15,20,22,25H,5-6,11-14,16-17H2/t20-,22+,25?,31-/m1/s1 |
| InChIKey | VMOUZTWSGJAMQS-RQNUYIFXSA-N |
| XLogP | 4.96 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|