C25H26FN7O — CID 164860450
6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-3-(2,3-dihydrofuro[2,3-b]pyridine-4-carboximidoyl)pyrazin-2-amine (PubChem CID 164860450) has the molecular formula C25H26FN7O and a molecular weight of 459.53 g/mol. Its IUPAC name is 6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-3-(2,3-dihydrofuro[2,3-b]pyridine-4-carboximidoyl)pyrazin-2-amine.
| Compound Name | 6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-3-(2,3-dihydrofuro[2,3-b]pyridine-4-carboximidoyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 164860450 |
| Molecular Formula | C25H26FN7O |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-3-(2,3-dihydrofuro[2,3-b]pyridine-4-carboximidoyl)pyrazin-2-amine |
| SMILES | [H]/N=C(\c1ccnc2c1CCO2)c1ncc(N2CC[C@@H]3[C@H](C2)[C@@]3(CN)c2ccccc2F)nc1N |
| InChI | InChI=1S/C25H26FN7O/c26-19-4-2-1-3-17(19)25(13-27)16-6-9-33(12-18(16)25)20-11-31-22(23(29)32-20)21(28)14-5-8-30-24-15(14)7-10-34-24/h1-5,8,11,16,18,28H,6-7,9-10,12-13,27H2,(H2,29,32)/b28-21+/t16-,18+,25-/m1/s1 |
| InChIKey | BTYXKMAWPXTMQR-IOVKIPLZSA-N |
| XLogP | 2.30 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|