C13H15NO6S — CID 164860562
benzyl (3aS,7aR)-2,2-dioxo-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate (PubChem CID 164860562) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is benzyl (3aS,7aR)-2,2-dioxo-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl (3aS,7aR)-2,2-dioxo-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 164860562 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | benzyl (3aS,7aR)-2,2-dioxo-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@H]2OS(=O)(=O)O[C@H]2C1 |
| InChI | InChI=1S/C13H15NO6S/c15-13(18-9-10-4-2-1-3-5-10)14-7-6-11-12(8-14)20-21(16,17)19-11/h1-5,11-12H,6-9H2/t11-,12+/m1/s1 |
| InChIKey | AHOACMUNZTUPIF-NEPJUHHUSA-N |
| XLogP | 1.06 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |