C25H22FN7O3S — CID 164860925
6-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 164860925) has the molecular formula C25H22FN7O3S and a molecular weight of 519.56 g/mol. Its IUPAC name is 6-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 6-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 164860925 |
| Molecular Formula | C25H22FN7O3S |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 6-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | NC[C@]1(c2ccccc2F)[C@@H]2CCN(c3cnc4c(-c5ccc6c(c5)S(=O)(=O)NC6=O)[nH]nc4n3)C[C@@H]21 |
| InChI | InChI=1S/C25H22FN7O3S/c26-18-4-2-1-3-16(18)25(12-27)15-7-8-33(11-17(15)25)20-10-28-22-21(30-31-23(22)29-20)13-5-6-14-19(9-13)37(35,36)32-24(14)34/h1-6,9-10,15,17H,7-8,11-12,27H2,(H,32,34)(H,29,30,31)/t15-,17+,25-/m1/s1 |
| InChIKey | RGBFGLIITGJQRF-VFHHBZAHSA-N |
| XLogP | 1.94 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |