C26H24FN7O2 — CID 164860946
6-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 164860946) has the molecular formula C26H24FN7O2 and a molecular weight of 485.52 g/mol. Its IUPAC name is 6-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 164860946 |
| Molecular Formula | C26H24FN7O2 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 6-[6-[(1S,6R,7R)-7-(aminomethyl)-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptan-3-yl]-2H-pyrazolo[3,4-b]pyrazin-3-yl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(-c3[nH]nc4nc(N5CC[C@@H]6[C@H](C5)[C@@]6(CN)c5ccccc5F)cnc34)ccc21 |
| InChI | InChI=1S/C26H24FN7O2/c1-33-19-7-6-14(10-20(19)36-25(33)35)22-23-24(32-31-22)30-21(11-29-23)34-9-8-15-17(12-34)26(15,13-28)16-4-2-3-5-18(16)27/h2-7,10-11,15,17H,8-9,12-13,28H2,1H3,(H,30,31,32)/t15-,17+,26-/m1/s1 |
| InChIKey | AOYOIONCRXEFMR-RSBAUJLWSA-N |
| XLogP | 2.96 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |