C9H17NO — CID 164861310
ethane;2-methoxycyclohexa-1,5-dien-1-amine (PubChem CID 164861310) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is ethane;2-methoxycyclohexa-1,5-dien-1-amine.
| Compound Name | ethane;2-methoxycyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 164861310 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | ethane;2-methoxycyclohexa-1,5-dien-1-amine |
| SMILES | CC.COC1=C(N)C=CCC1 |
| InChI | InChI=1S/C7H11NO.C2H6/c1-9-7-5-3-2-4-6(7)8;1-2/h2,4H,3,5,8H2,1H3;1-2H3 |
| InChIKey | CHLJUFGYZNAMNC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |