C22H26Cl2N4OS2 — CID 164863714
N-(3,4-dichloro-1H-indol-7-yl)-4-[piperidin-4-yl(propyl)amino]sulfanylbenzenesulfinamide (PubChem CID 164863714) has the molecular formula C22H26Cl2N4OS2 and a molecular weight of 497.52 g/mol. Its IUPAC name is N-(3,4-dichloro-1H-indol-7-yl)-4-[piperidin-4-yl(propyl)amino]sulfanylbenzenesulfinamide.
| Compound Name | N-(3,4-dichloro-1H-indol-7-yl)-4-[piperidin-4-yl(propyl)amino]sulfanylbenzenesulfinamide |
|---|---|
| PubChem CID | 164863714 |
| Molecular Formula | C22H26Cl2N4OS2 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | N-(3,4-dichloro-1H-indol-7-yl)-4-[piperidin-4-yl(propyl)amino]sulfanylbenzenesulfinamide |
| SMILES | CCCN(Sc1ccc(S(=O)Nc2ccc(Cl)c3c(Cl)c[nH]c23)cc1)C1CCNCC1 |
| InChI | InChI=1S/C22H26Cl2N4OS2/c1-2-13-28(15-9-11-25-12-10-15)30-16-3-5-17(6-4-16)31(29)27-20-8-7-18(23)21-19(24)14-26-22(20)21/h3-8,14-15,25-27H,2,9-13H2,1H3 |
| InChIKey | SDYXWOLYVMQQQH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|