C27H38N4O4 — CID 164864832
cis-(1R,2S)-2-[(1R)-1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)-3-methoxypropyl]-1-ethenyl-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]cyclopropane-1-carboxamide (PubChem CID 164864832) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(1R)-1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)-3-methoxypropyl]-1-ethenyl-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-[(1R)-1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)-3-methoxypropyl]-1-ethenyl-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 164864832 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | cis-(1R,2S)-2-[(1R)-1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)-3-methoxypropyl]-1-ethenyl-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]cyclopropane-1-carboxamide |
| SMILES | C=C[C@]1(C(=O)N[C@@H]2c3ccccc3C[C@@H]2O)C[C@@H]1[C@@H](CCOC)N1C(=O)CC(CC)(CC)N=C1N |
| InChI | InChI=1S/C27H38N4O4/c1-5-26(6-2)16-22(33)31(25(28)30-26)20(12-13-35-4)19-15-27(19,7-3)24(34)29-23-18-11-9-8-10-17(18)14-21(23)32/h7-11,19-21,23,32H,3,5-6,12-16H2,1-2,4H3,(H2,28,30)(H,29,34)/t19-,20-,21+,23-,27+/m1/s1 |
| InChIKey | IALAOWNMFGXMJA-XXXNKJRRSA-N |
| XLogP | 2.46 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|