C23H32N4O3 — CID 171442177
trans-(1R,2R)-2-[(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)methyl]-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-methylcyclopropane-1-carboxamide (PubChem CID 171442177) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)methyl]-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-[(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)methyl]-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 171442177 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | trans-(1R,2R)-2-[(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)methyl]-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-methylcyclopropane-1-carboxamide |
| SMILES | CCC1(CC)CC(=O)N(C[C@@H]2C(C)[C@H]2C(=O)N[C@@H]2c3ccccc3C[C@@H]2O)C(N)=N1 |
| InChI | InChI=1S/C23H32N4O3/c1-4-23(5-2)11-18(29)27(22(24)26-23)12-16-13(3)19(16)21(30)25-20-15-9-7-6-8-14(15)10-17(20)28/h6-9,13,16-17,19-20,28H,4-5,10-12H2,1-3H3,(H2,24,26)(H,25,30)/t13?,16-,17+,19-,20-/m1/s1 |
| InChIKey | LYAQZRVNDWMPSN-HUHAIQNGSA-N |
| XLogP | 1.75 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |