C22H30FN3O2 — CID 164868212
2-[(2-cyclopropyl-2-azaspiro[3.5]nonan-7-yl)methyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 164868212) has the molecular formula C22H30FN3O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-[(2-cyclopropyl-2-azaspiro[3.5]nonan-7-yl)methyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | 2-[(2-cyclopropyl-2-azaspiro[3.5]nonan-7-yl)methyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 164868212 |
| Molecular Formula | C22H30FN3O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-[(2-cyclopropyl-2-azaspiro[3.5]nonan-7-yl)methyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | O=C(NO)c1cc(F)c2c(c1)CCN(CC1CCC3(CC1)CN(C1CC1)C3)C2 |
| InChI | InChI=1S/C22H30FN3O2/c23-20-10-17(21(27)24-28)9-16-5-8-25(12-19(16)20)11-15-3-6-22(7-4-15)13-26(14-22)18-1-2-18/h9-10,15,18,28H,1-8,11-14H2,(H,24,27) |
| InChIKey | YVWIJVZXAPUVCY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|