C21H28FN3O2 — CID 164868826
2-(2-cyclopropyl-2-azaspiro[3.5]nonan-7-yl)-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 164868826) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-(2-cyclopropyl-2-azaspiro[3.5]nonan-7-yl)-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | 2-(2-cyclopropyl-2-azaspiro[3.5]nonan-7-yl)-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 164868826 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-(2-cyclopropyl-2-azaspiro[3.5]nonan-7-yl)-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | O=C(NO)c1cc(F)c2c(c1)CCN(C1CCC3(CC1)CN(C1CC1)C3)C2 |
| InChI | InChI=1S/C21H28FN3O2/c22-19-10-15(20(26)23-27)9-14-5-8-24(11-18(14)19)17-3-6-21(7-4-17)12-25(13-21)16-1-2-16/h9-10,16-17,27H,1-8,11-13H2,(H,23,26) |
| InChIKey | DMXWYMNSAGOCOA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|