C31H32FN9O4 — CID 164870238
1-[4-[[4-[4-[(E,3E)-1-amino-3-(6-methoxypyrimidin-4-yl)iminoprop-1-enoxy]-2-fluoroanilino]-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 164870238) has the molecular formula C31H32FN9O4 and a molecular weight of 613.65 g/mol. Its IUPAC name is 1-[4-[[4-[4-[(E,3E)-1-amino-3-(6-methoxypyrimidin-4-yl)iminoprop-1-enoxy]-2-fluoroanilino]-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[4-[4-[(E,3E)-1-amino-3-(6-methoxypyrimidin-4-yl)iminoprop-1-enoxy]-2-fluoroanilino]-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 164870238 |
| Molecular Formula | C31H32FN9O4 |
| Molecular Weight | 613.65 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | 1-[4-[[4-[4-[(E,3E)-1-amino-3-(6-methoxypyrimidin-4-yl)iminoprop-1-enoxy]-2-fluoroanilino]-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2cc3c(Nc4ccc(O/C(N)=C/C=N/c5cc(OC)ncn5)cc4F)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C31H32FN9O4/c1-4-30(42)41-11-8-19(9-12-41)39-25-14-21-24(15-26(25)43-2)35-17-38-31(21)40-23-6-5-20(13-22(23)32)45-27(33)7-10-34-28-16-29(44-3)37-18-36-28/h4-7,10,13-19,39H,1,8-9,11-12,33H2,2-3H3,(H,35,38,40)/b27-7+,34-10+ |
| InChIKey | WKCRXTVAJAQYOX-IVEUXPBHSA-N |
| XLogP | 4.49 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|