C32H32ClFN8O3 — CID 164869986
1-[4-[[4-[4-[(E)-1-amino-3-[(4-fluoro-5-methyl-2-pyridinyl)imino]prop-1-enoxy]-3-chloroanilino]-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 164869986) has the molecular formula C32H32ClFN8O3 and a molecular weight of 631.11 g/mol. Its IUPAC name is 1-[4-[[4-[4-[(E)-1-amino-3-[(4-fluoro-5-methyl-2-pyridinyl)imino]prop-1-enoxy]-3-chloroanilino]-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[4-[4-[(E)-1-amino-3-[(4-fluoro-5-methyl-2-pyridinyl)imino]prop-1-enoxy]-3-chloroanilino]-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 164869986 |
| Molecular Formula | C32H32ClFN8O3 |
| Molecular Weight | 631.11 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 1-[4-[[4-[4-[(E)-1-amino-3-[(4-fluoro-5-methyl-2-pyridinyl)imino]prop-1-enoxy]-3-chloroanilino]-7-methoxyquinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2cc3c(Nc4ccc(O/C(N)=C/C=N/c5cc(F)c(C)cn5)c(Cl)c4)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C32H32ClFN8O3/c1-4-31(43)42-11-8-20(9-12-42)40-26-14-22-25(16-28(26)44-3)38-18-39-32(22)41-21-5-6-27(23(33)13-21)45-29(35)7-10-36-30-15-24(34)19(2)17-37-30/h4-7,10,13-18,20,40H,1,8-9,11-12,35H2,2-3H3,(H,38,39,41)/b29-7+,36-10+ |
| InChIKey | MUPQLIKGJVEZGS-UNYVMCIESA-N |
| XLogP | 6.05 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.11 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|