C24H24BrF2N5O3 — CID 166086283
1-[4-[[4-(5-bromo-2-methoxyanilino)-7-(difluoromethoxy)quinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166086283) has the molecular formula C24H24BrF2N5O3 and a molecular weight of 548.39 g/mol. Its IUPAC name is 1-[4-[[4-(5-bromo-2-methoxyanilino)-7-(difluoromethoxy)quinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[4-(5-bromo-2-methoxyanilino)-7-(difluoromethoxy)quinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166086283 |
| Molecular Formula | C24H24BrF2N5O3 |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 1-[4-[[4-(5-bromo-2-methoxyanilino)-7-(difluoromethoxy)quinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2cc3c(Nc4cc(Br)ccc4OC)ncnc3cc2OC(F)F)CC1 |
| InChI | InChI=1S/C24H24BrF2N5O3/c1-3-22(33)32-8-6-15(7-9-32)30-19-11-16-17(12-21(19)35-24(26)27)28-13-29-23(16)31-18-10-14(25)4-5-20(18)34-2/h3-5,10-13,15,24,30H,1,6-9H2,2H3,(H,28,29,31) |
| InChIKey | WDDCPQYIZNTYNL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|