C32H37FN8O3 — CID 164870240
4-[[4-[4-[2-(cyclobutylamino)pyrimidin-4-yl]oxy-2-fluoroanilino]-7-methoxyquinazolin-6-yl]amino]piperidine-1-carbaldehyde;prop-1-ene (PubChem CID 164870240) has the molecular formula C32H37FN8O3 and a molecular weight of 600.70 g/mol. Its IUPAC name is 4-[[4-[4-[2-(cyclobutylamino)pyrimidin-4-yl]oxy-2-fluoroanilino]-7-methoxyquinazolin-6-yl]amino]piperidine-1-carbaldehyde;prop-1-ene.
| Compound Name | 4-[[4-[4-[2-(cyclobutylamino)pyrimidin-4-yl]oxy-2-fluoroanilino]-7-methoxyquinazolin-6-yl]amino]piperidine-1-carbaldehyde;prop-1-ene |
|---|---|
| PubChem CID | 164870240 |
| Molecular Formula | C32H37FN8O3 |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | 4-[[4-[4-[2-(cyclobutylamino)pyrimidin-4-yl]oxy-2-fluoroanilino]-7-methoxyquinazolin-6-yl]amino]piperidine-1-carbaldehyde;prop-1-ene |
| SMILES | C=CC.COc1cc2ncnc(Nc3ccc(Oc4ccnc(NC5CCC5)n4)cc3F)c2cc1NC1CCN(C=O)CC1 |
| InChI | InChI=1S/C29H31FN8O3.C3H6/c1-40-26-15-24-21(14-25(26)34-19-8-11-38(17-39)12-9-19)28(33-16-32-24)36-23-6-5-20(13-22(23)30)41-27-7-10-31-29(37-27)35-18-3-2-4-18;1-3-2/h5-7,10,13-19,34H,2-4,8-9,11-12H2,1H3,(H,31,35,37)(H,32,33,36);3H,1H2,2H3 |
| InChIKey | GWPOEZHJGMOOIY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|