C20H22F3N3O2S — CID 164872042
benzene;3-hydroxy-1-[2-[(3Z)-5,5,5-trifluoro-4-methylpenta-1,3-dien-3-yl]sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]propan-1-one (PubChem CID 164872042) has the molecular formula C20H22F3N3O2S and a molecular weight of 425.48 g/mol. Its IUPAC name is benzene;3-hydroxy-1-[2-[(3Z)-5,5,5-trifluoro-4-methylpenta-1,3-dien-3-yl]sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]propan-1-one.
| Compound Name | benzene;3-hydroxy-1-[2-[(3Z)-5,5,5-trifluoro-4-methylpenta-1,3-dien-3-yl]sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 164872042 |
| Molecular Formula | C20H22F3N3O2S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | benzene;3-hydroxy-1-[2-[(3Z)-5,5,5-trifluoro-4-methylpenta-1,3-dien-3-yl]sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]propan-1-one |
| SMILES | C=C/C(Sn1cc2c(n1)CN(C(=O)CCO)C2)=C(\C)C(F)(F)F.c1ccccc1 |
| InChI | InChI=1S/C14H16F3N3O2S.C6H6/c1-3-12(9(2)14(15,16)17)23-20-7-10-6-19(8-11(10)18-20)13(22)4-5-21;1-2-4-6-5-3-1/h3,7,21H,1,4-6,8H2,2H3;1-6H/b12-9-; |
| InChIKey | HNPLVADDADDNPG-MWMYENNMSA-N |
| XLogP | 4.31 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|