2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid

C7H9N3O2 — CID 175331186

IUPAC2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid
SMILESCn1cc2c(n1)CN(C(=O)O)C2
InChIInChI=1S/C7H9N3O2/c1-9-2-5-3-10(7(11)12)4-6(5)8-9/h2H,3-4H2,1H3,(H,11,12)
InChIKeyDQVHBDLJUXKKSE-UHFFFAOYSA-N
MW167.17 g/mol
LogP0.41
Rot. Bonds

About 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid

2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid (PubChem CID 175331186) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid.

Molecular Properties

Compound Name2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid
PubChem CID175331186
Molecular FormulaC7H9N3O2
Molecular Weight167.17 g/mol
Exact Mass167.07
IUPAC Name2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid
SMILESCn1cc2c(n1)CN(C(=O)O)C2
InChIInChI=1S/C7H9N3O2/c1-9-2-5-3-10(7(11)12)4-6(5)8-9/h2H,3-4H2,1H3,(H,11,12)
InChIKeyDQVHBDLJUXKKSE-UHFFFAOYSA-N
XLogP0.41
TPSA58.36 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.17
LogP ≤ 50.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid?
The IUPAC name of 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid (CID 175331186) is 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid.
What is the SMILES notation for 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid?
The canonical SMILES for 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid is Cn1cc2c(n1)CN(C(=O)O)C2.
What is the InChIKey of 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid?
The InChIKey is DQVHBDLJUXKKSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c1-9-2-5-3-10(7(11)12)4-6(5)8-9/h2H,3-4H2,1H3,(H,11,12).
What are the key properties of 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid?
2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid has a molecular weight of 167.17 g/mol, XLogP of 0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid is sourced from PubChem (CID 175331186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).