About 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole
2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole (PubChem CID 22087040) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole.
Analyze 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole?
The IUPAC name of 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole (CID 22087040) is 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole.
What is the SMILES notation for 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole?
The canonical SMILES for 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole is CN1Cc2cn(C)nc2C1.
What is the InChIKey of 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole?
The InChIKey is DQVDUFXRKFSPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-9-3-6-4-10(2)8-7(6)5-9/h4H,3,5H2,1-2H3.
What are the key properties of 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole?
2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole has a molecular weight of 137.19 g/mol, XLogP of 0.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole is sourced from PubChem (CID 22087040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).