C26H26BrF3N4O7 — CID 164873656
(2R,3R,4S,5R,6R)-N-(3-bromophenyl)-5-hydroxy-6-(hydroxymethyl)-N-[(3R,4S)-4-hydroxyoxolan-3-yl]-3-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide (PubChem CID 164873656) has the molecular formula C26H26BrF3N4O7 and a molecular weight of 643.41 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-N-(3-bromophenyl)-5-hydroxy-6-(hydroxymethyl)-N-[(3R,4S)-4-hydroxyoxolan-3-yl]-3-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R,6R)-N-(3-bromophenyl)-5-hydroxy-6-(hydroxymethyl)-N-[(3R,4S)-4-hydroxyoxolan-3-yl]-3-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 164873656 |
| Molecular Formula | C26H26BrF3N4O7 |
| Molecular Weight | 643.41 g/mol |
| Exact Mass | 642.09 |
| IUPAC Name | (2R,3R,4S,5R,6R)-N-(3-bromophenyl)-5-hydroxy-6-(hydroxymethyl)-N-[(3R,4S)-4-hydroxyoxolan-3-yl]-3-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@H]1C(=O)N(c1cccc(Br)c1)[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C26H26BrF3N4O7/c1-39-24-22(33-8-17(31-32-33)12-5-15(28)21(30)16(29)6-12)23(37)20(9-35)41-25(24)26(38)34(18-10-40-11-19(18)36)14-4-2-3-13(27)7-14/h2-8,18-20,22-25,35-37H,9-11H2,1H3/t18-,19-,20-,22+,23+,24-,25-/m1/s1 |
| InChIKey | YVEKFBJFRRXVJV-GMMOQORGSA-N |
| XLogP | 1.59 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|