C14H17BrF2N2O2S2 — CID 164875057
2-bromo-N-(4,4-difluorocyclohexyl)-3-methyl-2H-1,3-benzothiazole-6-sulfonamide (PubChem CID 164875057) has the molecular formula C14H17BrF2N2O2S2 and a molecular weight of 427.34 g/mol. Its IUPAC name is 2-bromo-N-(4,4-difluorocyclohexyl)-3-methyl-2H-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 2-bromo-N-(4,4-difluorocyclohexyl)-3-methyl-2H-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 164875057 |
| Molecular Formula | C14H17BrF2N2O2S2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 2-bromo-N-(4,4-difluorocyclohexyl)-3-methyl-2H-1,3-benzothiazole-6-sulfonamide |
| SMILES | CN1c2ccc(S(=O)(=O)NC3CCC(F)(F)CC3)cc2SC1Br |
| InChI | InChI=1S/C14H17BrF2N2O2S2/c1-19-11-3-2-10(8-12(11)22-13(19)15)23(20,21)18-9-4-6-14(16,17)7-5-9/h2-3,8-9,13,18H,4-7H2,1H3 |
| InChIKey | JSUKYFVYECUKSL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|