C29H40ClF2N5O — CID 164875796
(2S)-2-[2-[6-chloro-8-fluoro-7-[(1Z,3E,5E)-6-fluoro-3-methanimidoyl-2-(methylamino)hexa-1,3,5-trienyl]-2-methoxy-4-methylquinazolin-5-yl]ethyl]-3-methyl-N-propylpentan-1-amine (PubChem CID 164875796) has the molecular formula C29H40ClF2N5O and a molecular weight of 548.12 g/mol. Its IUPAC name is (2S)-2-[2-[6-chloro-8-fluoro-7-[(1Z,3E,5E)-6-fluoro-3-methanimidoyl-2-(methylamino)hexa-1,3,5-trienyl]-2-methoxy-4-methylquinazolin-5-yl]ethyl]-3-methyl-N-propylpentan-1-amine.
| Compound Name | (2S)-2-[2-[6-chloro-8-fluoro-7-[(1Z,3E,5E)-6-fluoro-3-methanimidoyl-2-(methylamino)hexa-1,3,5-trienyl]-2-methoxy-4-methylquinazolin-5-yl]ethyl]-3-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 164875796 |
| Molecular Formula | C29H40ClF2N5O |
| Molecular Weight | 548.12 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | (2S)-2-[2-[6-chloro-8-fluoro-7-[(1Z,3E,5E)-6-fluoro-3-methanimidoyl-2-(methylamino)hexa-1,3,5-trienyl]-2-methoxy-4-methylquinazolin-5-yl]ethyl]-3-methyl-N-propylpentan-1-amine |
| SMILES | [H]/N=C/C(=C/C=C/F)/C(=C/c1c(Cl)c(CC[C@H](CNCCC)C(C)CC)c2c(C)nc(OC)nc2c1F)NC |
| InChI | InChI=1S/C29H40ClF2N5O/c1-7-14-35-17-21(18(3)8-2)11-12-22-25-19(4)36-29(38-6)37-28(25)27(32)23(26(22)30)15-24(34-5)20(16-33)10-9-13-31/h9-10,13,15-16,18,21,33-35H,7-8,11-12,14,17H2,1-6H3/b13-9+,20-10-,24-15-,33-16+/t18?,21-/m1/s1 |
| InChIKey | ZOENIQIBVXBWDG-IKCDZALQSA-N |
| XLogP | 6.95 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.12 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|