About N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide
N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide (PubChem CID 164878265) has the molecular formula C8H13FN2
and a molecular weight of 156.20 g/mol. Its IUPAC name is N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide |
| PubChem CID | 164878265 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide |
| SMILES | C=C(C)/C(=C/F)N/C(C)=N/C |
| InChI | InChI=1S/C8H13FN2/c1-6(2)8(5-9)11-7(3)10-4/h5H,1H2,2-4H3,(H,10,11)/b8-5- |
| InChIKey | DHSCSXORKQSIMT-YVMONPNESA-N |
| XLogP | 2.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide?
The IUPAC name of N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide (CID 164878265) is N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide.
What is the SMILES notation for N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide?
The canonical SMILES for N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide is C=C(C)/C(=C/F)N/C(C)=N/C.
What is the InChIKey of N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide?
The InChIKey is DHSCSXORKQSIMT-YVMONPNESA-N. The full InChI is InChI=1S/C8H13FN2/c1-6(2)8(5-9)11-7(3)10-4/h5H,1H2,2-4H3,(H,10,11)/b8-5-.
What are the key properties of N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide?
N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide has a molecular weight of 156.20 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-1-fluoro-3-methylbuta-1,3-dien-2-yl]-N'-methylethanimidamide is sourced from PubChem (CID 164878265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).