About N-but-1-en-2-yl-N'-methylethanimidamide
N-but-1-en-2-yl-N'-methylethanimidamide (PubChem CID 89152931) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is N-but-1-en-2-yl-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-but-1-en-2-yl-N'-methylethanimidamide |
| PubChem CID | 89152931 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N-but-1-en-2-yl-N'-methylethanimidamide |
| SMILES | C=C(CC)N/C(C)=N/C |
| InChI | InChI=1S/C7H14N2/c1-5-6(2)9-7(3)8-4/h2,5H2,1,3-4H3,(H,8,9) |
| InChIKey | ZPRZEPYOWCQNOG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-but-1-en-2-yl-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-yl-N'-methylethanimidamide?
The IUPAC name of N-but-1-en-2-yl-N'-methylethanimidamide (CID 89152931) is N-but-1-en-2-yl-N'-methylethanimidamide.
What is the SMILES notation for N-but-1-en-2-yl-N'-methylethanimidamide?
The canonical SMILES for N-but-1-en-2-yl-N'-methylethanimidamide is C=C(CC)N/C(C)=N/C.
What is the InChIKey of N-but-1-en-2-yl-N'-methylethanimidamide?
The InChIKey is ZPRZEPYOWCQNOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-5-6(2)9-7(3)8-4/h2,5H2,1,3-4H3,(H,8,9).
What are the key properties of N-but-1-en-2-yl-N'-methylethanimidamide?
N-but-1-en-2-yl-N'-methylethanimidamide has a molecular weight of 126.20 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-yl-N'-methylethanimidamide is sourced from PubChem (CID 89152931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).